cas: 120-03-6 — see every product listed under this CAS number, including other names
2-(p-Tolyl)-1H-benzo[d]imidazole 97% (CAS 120-03-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A269095-10g |
| cas | 120-03-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 909.94 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 515.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A269095 |
2-(4-methylphenyl)-1H-benzimidazole (CAS 120-03-6) is a chemical compound with the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. IUPAC name: 2-(4-methylphenyl)-1H-benzimidazole. InChIKey: YJSWQFYMPODDTQ-UHFFFAOYSA-N.
| Molecular formula | C14H12N2 |
|---|---|
| Molecular weight | 208.26 g/mol |
| IUPAC name | 2-(4-methylphenyl)-1H-benzimidazole |
| InChIKey | YJSWQFYMPODDTQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)