2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%
cas: 99810-76-1 — see every product listed under this CAS number, including other names
2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 99810-76-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A118982-1g |
| cas | 99810-76-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 520.56 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 50g | 659.60 Pln | |
| Chemat | 100g | 1230.80 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 203.29 Pln | |
| BLDpharm | 10g | 269.93 Pln | |
| BLDpharm | 25g | 553.16 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 99810-76-1) is a chemical compound with the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. IUPAC name: 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZQEPUUOQJIWIFJ-UHFFFAOYSA-N.
| Molecular formula | C10H21BO2 |
|---|---|
| Molecular weight | 184.09 g/mol |
| IUPAC name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZQEPUUOQJIWIFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)
Synonyms:
TERT-BUTYLBORONIC ACID PINACOL ESTER, 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 1,3,2-Dioxaborolane, 2-(1,1-dimethylethyl)-4,4,5,5-tetramethyl-, tert-butyl boronic acid pinacol ester, 2-(tert-Butyl)-4455-tetramethyl-132-dioxaborolane