CAS 69190-62-1 appears in our catalog under these names: n–Butylboronic acid pinacol ester, 2-Butyl-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane, 98%, 2-Butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-Butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 250mg.
2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 69190-62-1) is a chemical compound with the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. IUPAC name: 2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZHBANXSNVFDSMK-UHFFFAOYSA-N.
| Molecular formula | C10H21BO2 |
|---|---|
| Molecular weight | 184.09 g/mol |
| IUPAC name | 2-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZHBANXSNVFDSMK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCCC |
Computed by PubChem (NCBI)