CAS 66217-57-0 appears in our catalog under these names: 2-(sec-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%, 2-(sec-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-butan-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 66217-57-0) is a chemical compound with the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. IUPAC name: 2-butan-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XGRHZVNMROMGKZ-UHFFFAOYSA-N.
| Molecular formula | C10H21BO2 |
|---|---|
| Molecular weight | 184.09 g/mol |
| IUPAC name | 2-butan-2-yl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XGRHZVNMROMGKZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)CC |
Computed by PubChem (NCBI)