CAS 99810-76-1 appears in our catalog under these names: tert-Butylboronic acid pinacol ester, 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97%, 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97%, 2-(tert-Butyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1000mg, 1g, 5g, 10g, 25g, 100g, 50g, 15g.
2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 99810-76-1) is a chemical compound with the molecular formula C10H21BO2 and a molecular weight of 184.09 g/mol. IUPAC name: 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZQEPUUOQJIWIFJ-UHFFFAOYSA-N.
| Molecular formula | C10H21BO2 |
|---|---|
| Molecular weight | 184.09 g/mol |
| IUPAC name | 2-tert-butyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZQEPUUOQJIWIFJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)