Products 2380306-51-2
CAS 2380306-51-2 is the registry number for 5-(tert-Butyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2380306-51-2) is a chemical compound with the molecular formula C16H26BNO2 and a molecular weight of 275.2 g/mol. IUPAC name: 5-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: JYEDYBOPWRCHJM-UHFFFAOYSA-N.
| Molecular formula | C16H26BNO2 |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 5-tert-butyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | JYEDYBOPWRCHJM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(C)(C)C)N |
Computed by PubChem (NCBI)