CAS 1221793-61-8 is the registry number for 1-Bromo-3-isopropoxy-5-trifluoromethoxybenzene, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-bromo-3-propan-2-yloxy-5-(trifluoromethoxy)benzene (CAS 1221793-61-8) is a chemical compound with the molecular formula C10H10BrF3O2 and a molecular weight of 299.08 g/mol. IUPAC name: 1-bromo-3-propan-2-yloxy-5-(trifluoromethoxy)benzene. InChIKey: BNLQWJWWOBHUGS-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O2 |
|---|---|
| Molecular weight | 299.08 g/mol |
| IUPAC name | 1-bromo-3-propan-2-yloxy-5-(trifluoromethoxy)benzene |
| InChIKey | BNLQWJWWOBHUGS-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1)Br)OC(F)(F)F |
Computed by PubChem (NCBI)