Products 200956-15-6
CAS 200956-15-6 appears in our catalog under these names: 2-Bromo-1-isopropoxy-4-(trifluoromethoxy)benzene, 95%, 2-Bromo-1-isopropoxy-4-(trifluoromethoxy)benzene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2-bromo-1-propan-2-yloxy-4-(trifluoromethoxy)benzene (CAS 200956-15-6) is a chemical compound with the molecular formula C10H10BrF3O2 and a molecular weight of 299.08 g/mol. IUPAC name: 2-bromo-1-propan-2-yloxy-4-(trifluoromethoxy)benzene. InChIKey: IULMXYSSKXYIOB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrF3O2 |
|---|---|
| Molecular weight | 299.08 g/mol |
| IUPAC name | 2-bromo-1-propan-2-yloxy-4-(trifluoromethoxy)benzene |
| InChIKey | IULMXYSSKXYIOB-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C=C(C=C1)OC(F)(F)F)Br |
Computed by PubChem (NCBI)