cas: 89336-46-9 — see every product listed under this CAS number, including other names
2-[2-[(tert-Butoxycarbonyl)amino]thiazol-4-yl]acetic Acid, >98.0%(T)(HPLC) (CAS 89336-46-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B6173-250MG |
| cas | 89336-46-9 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 128.18 Pln | |
| TCI | 1g | 359.29 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(HPLC) |
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 89336-46-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: LNUBPLFRRHJPLI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | LNUBPLFRRHJPLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)CC(=O)O |
Computed by PubChem (NCBI)