CAS 931852-18-5 is the registry number for N-Isopropyl-2-methyl-5-nitrobenzenesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
2-methyl-5-nitro-N-propan-2-ylbenzenesulfonamide (CAS 931852-18-5) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-methyl-5-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: JELKOJXTVHYEMN-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-methyl-5-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | JELKOJXTVHYEMN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])S(=O)(=O)NC(C)C |
Computed by PubChem (NCBI)