Products 1820638-90-1
CAS 1820638-90-1 is the registry number for N-(4-Nitrophenyl)-N-propylmethanesulfonamide, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g.
N-(4-nitrophenyl)-N-propylmethanesulfonamide (CAS 1820638-90-1) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: N-(4-nitrophenyl)-N-propylmethanesulfonamide. InChIKey: XCTOOKPFFUTRFN-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | N-(4-nitrophenyl)-N-propylmethanesulfonamide |
| InChIKey | XCTOOKPFFUTRFN-UHFFFAOYSA-N |
| SMILES | CCCN(C1=CC=C(C=C1)[N+](=O)[O-])S(=O)(=O)C |
Computed by PubChem (NCBI)