CAS 89336-46-9 appears in our catalog under these names: (2-tert-Butoxycarbonylamino-thiazol-4-yl)-acetic acid, 98%, Boc-2-amino-4-thiazole Acetic Acid, >95% (HPLC), 2-[2-[(tert-Butoxycarbonyl)amino]thiazol-4-yl]acetic Acid, >98.0%(T)(HPLC), 2-(2-((tert-Butoxycarbonyl)amino)thiazol-4-yl)acetic acid 98%, 4-Thiazoleacetic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]-, 97%, 97%. Offered by: Combi-blocks, TRC, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg, 100mg, 100g.
2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 89336-46-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: LNUBPLFRRHJPLI-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | LNUBPLFRRHJPLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC(=CS1)CC(=O)O |
Computed by PubChem (NCBI)