cas: 2304635-75-2 — see every product listed under this CAS number, including other names
2-[3-(Trifluoromethyl)benzamido]phenylboronic Acid, ≥95%, ≥95% (CAS 2304635-75-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12TI5D-100mg |
| cas | 2304635-75-2 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 832.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
[2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid (CAS 2304635-75-2) is a chemical compound with the molecular formula C14H11BF3NO3 and a molecular weight of 309.05 g/mol. IUPAC name: [2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid. InChIKey: UEKLJVKFHIDUJV-UHFFFAOYSA-N.
| Molecular formula | C14H11BF3NO3 |
|---|---|
| Molecular weight | 309.05 g/mol |
| IUPAC name | [2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid |
| InChIKey | UEKLJVKFHIDUJV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C2=CC(=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)