Products 913835-42-4

CAS 913835-42-4 is the registry number for N-2-Trifluoromethylphenyl 4-boronobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]boronic acid (CAS 913835-42-4) is a chemical compound with the molecular formula C14H11BF3NO3 and a molecular weight of 309.05 g/mol. IUPAC name: [4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]boronic acid. InChIKey: GMSZJSZMTXJQRP-UHFFFAOYSA-N.

Identity
Molecular formulaC14H11BF3NO3
Molecular weight309.05 g/mol
IUPAC name[4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]boronic acid
InChIKeyGMSZJSZMTXJQRP-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2C(F)(F)F)(O)O

Computed by PubChem (NCBI)