CAS 2304635-75-2 appears in our catalog under these names: 2-[3-(Trifluoromethyl)benzamido]phenylboronic acid, 95%, 2-[3-(Trifluoromethyl)benzamido]phenylboronic Acid, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg.
[2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid (CAS 2304635-75-2) is a chemical compound with the molecular formula C14H11BF3NO3 and a molecular weight of 309.05 g/mol. IUPAC name: [2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid. InChIKey: UEKLJVKFHIDUJV-UHFFFAOYSA-N.
| Molecular formula | C14H11BF3NO3 |
|---|---|
| Molecular weight | 309.05 g/mol |
| IUPAC name | [2-[[3-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid |
| InChIKey | UEKLJVKFHIDUJV-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1NC(=O)C2=CC(=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)