CAS 276669-71-7 appears in our catalog under these names: [3-[[4-(Trifluoromethyl)benzoyl]amino]phenyl]boronic acid, 95%, (3–((4–(Trifluoromethyl)benzoyl)amino)phenyl)boronic acid, (3-(4-(Trifluoromethyl)benzamido)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 50mg.
[3-[[4-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid (CAS 276669-71-7) is a chemical compound with the molecular formula C14H11BF3NO3 and a molecular weight of 309.05 g/mol. IUPAC name: [3-[[4-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid. InChIKey: BFCPMCGIDQMEMM-UHFFFAOYSA-N.
| Molecular formula | C14H11BF3NO3 |
|---|---|
| Molecular weight | 309.05 g/mol |
| IUPAC name | [3-[[4-(trifluoromethyl)benzoyl]amino]phenyl]boronic acid |
| InChIKey | BFCPMCGIDQMEMM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C2=CC=C(C=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)