2-[4-(3-Chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95%, >95%
cas: 889865-32-1 — see every product listed under this CAS number, including other names
2-[4-(3-Chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, >95%, >95% (CAS 889865-32-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IFJ5-100mg |
| cas | 889865-32-1 |
| size | 100mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1235.60 Pln | |
| Chemat | 250mg | 1432.40 Pln | |
| Chemat | 1g | 1715.60 Pln | |
| Chemat | 5g | 3506.00 Pln | |
| Chemat | 10g | 5229.20 Pln |
properties
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 889865-32-1) is a chemical compound with the molecular formula C15H22BClO3 and a molecular weight of 296.6 g/mol. IUPAC name: 2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: OPQUKGKJTWQAKY-UHFFFAOYSA-N.
| Molecular formula | C15H22BClO3 |
|---|---|
| Molecular weight | 296.6 g/mol |
| IUPAC name | 2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | OPQUKGKJTWQAKY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OCCCCl |
Computed by PubChem (NCBI)
Synonyms:
2-[4-(3-chloropropoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4-(3-Chloropropoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-(3-Chloropropoxy)phenylboronic Acid Pinacol Ester, OPQUKGKJTWQAKY-UHFFFAOYSA-N, 2-[4-(3-chloro-propoxy)-phenyl]-4,4,5,5-tetramethyl-[1,3,2]dioxaborolane