cas: 153402-45-0 — see every product listed under this CAS number, including other names
2-[4-(METHYLSULFONYL)PHENYL]ETHYLAMINE (CAS 153402-45-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387557-250MG |
| cas | 153402-45-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 1g | 732.05 Pln |
| delivery time | 3-4 weeks |
|---|
2-(4-methylsulfonylphenyl)ethanamine (CAS 153402-45-0) is a chemical compound with the molecular formula C9H13NO2S and a molecular weight of 199.27 g/mol. IUPAC name: 2-(4-methylsulfonylphenyl)ethanamine. InChIKey: XFXSJOHJDZJFCP-UHFFFAOYSA-N.
| Molecular formula | C9H13NO2S |
|---|---|
| Molecular weight | 199.27 g/mol |
| IUPAC name | 2-(4-methylsulfonylphenyl)ethanamine |
| InChIKey | XFXSJOHJDZJFCP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)CCN |
Computed by PubChem (NCBI)