cas: 733795-51-2 — see every product listed under this CAS number, including other names
2-{((4,6-dimethylpyrimidin-2-yl)sulfanyl)methyl}benzoic acid, 95% (CAS 733795-51-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1010470-10g |
| cas | 733795-51-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19365.64 Pln | |
| AmBeed | 5g | 12341.35 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoic acid (CAS 733795-51-2) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoic acid. InChIKey: XOAMWXDLWBTICO-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | 2-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoic acid |
| InChIKey | XOAMWXDLWBTICO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)SCC2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)