CAS 854035-83-9 is the registry number for N-(2,3-Dimethylphenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2,3-dimethylphenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide (CAS 854035-83-9) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: N-(2,3-dimethylphenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide. InChIKey: CGJPIIWRGLZOTC-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | N-(2,3-dimethylphenyl)-N-(4-formyl-1,3-thiazol-2-yl)acetamide |
| InChIKey | CGJPIIWRGLZOTC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N(C2=NC(=CS2)C=O)C(=O)C)C |
Computed by PubChem (NCBI)