CAS 55011-44-4 appears in our catalog under these names: O-Tolidine sulfone, 70%, 3,7–Diamino–2,8–dimethyldibenzothiophene sulfone (contains 2,6–Dimethyl isomer), 3,7-Diamino-2,8-dimethyldibenzothiophene sulfone, contains 2,6-Dimethyl isomer, 3,7-Diamino-2,8-dimethyldibenzothiophene Sulfone (contains 2,6-Dimethyl isomer), >70.0%(HPLC), 3,7-Diamino-2,8-dimethyldibenzo[b,d]thiophene 5,5-dioxide 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g, 500g, 10g.
2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine (CAS 55011-44-4) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: 2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine. InChIKey: OJSPYCPPVCMEBS-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | 2,8-dimethyl-5,5-dioxodibenzothiophene-3,7-diamine |
| InChIKey | OJSPYCPPVCMEBS-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1N)S(=O)(=O)C3=C2C=C(C(=C3)N)C |
Computed by PubChem (NCBI)