CAS 1006894-79-6 is the registry number for 4-Methyl-2-(phenylmethylene)hydrazide Benzenesulfonic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide (CAS 1006894-79-6) is a chemical compound with the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. IUPAC name: N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide. InChIKey: FZFLTDNAHASQQC-RVDMUPIBSA-N.
| Molecular formula | C14H14N2O2S |
|---|---|
| Molecular weight | 274.34 g/mol |
| IUPAC name | N-[(E)-benzylideneamino]-4-methylbenzenesulfonamide |
| InChIKey | FZFLTDNAHASQQC-RVDMUPIBSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N/N=C/C2=CC=CC=C2 |
Computed by PubChem (NCBI)