cas: 2097954-55-5 — see every product listed under this CAS number, including other names
2-{[(tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid, 97%, 97% (CAS 2097954-55-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch13DRB6-100mg |
| cas | 2097954-55-5 |
| size | 100mg |
| availability | 10g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1322.00 Pln | |
| Chemat | 500mg | 1864.40 Pln | |
| Chemat | 1g | 2637.20 Pln | |
| Chemat | 5g | 7782.80 Pln | |
| Chemat | 10g | 12928.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2097954-55-5) is a chemical compound with the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. IUPAC name: 5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: FONPOKVADVHMTQ-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO4 |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | 5,5-difluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | FONPOKVADVHMTQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(F)F)C(=O)O |
Computed by PubChem (NCBI)