CAS 2660254-91-9 is the registry number for rel-tert-Butyl (4R,5R)-3,3-difluoro-4,5-dihydroxypiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (4R,5R)-3,3-difluoro-4,5-dihydroxypiperidine-1-carboxylate (CAS 2660254-91-9) is a chemical compound with the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. IUPAC name: tert-butyl (4R,5R)-3,3-difluoro-4,5-dihydroxypiperidine-1-carboxylate. InChIKey: IKWHPPPLWWZCMH-RNFRBKRXSA-N.
| Molecular formula | C10H17F2NO4 |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | tert-butyl (4R,5R)-3,3-difluoro-4,5-dihydroxypiperidine-1-carboxylate |
| InChIKey | IKWHPPPLWWZCMH-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]([C@H](C(C1)(F)F)O)O |
Computed by PubChem (NCBI)