CAS 1400264-85-8 appears in our catalog under these names: tert–Butyl 3,3–difluoro–4–oxopiperidine–1–carboxylate hydrate, tert-Butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate hydrate 98%, Tert-Butyl 3,3-Difluoro-4-Oxopiperidine-1-Carboxylate Hydrate, 98%, 98%, tert-Butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate hydrate, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 100g.
Tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate;hydrate (CAS 1400264-85-8) is a chemical compound with the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. IUPAC name: tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate;hydrate. InChIKey: IEESRSKOIOREKD-UHFFFAOYSA-N.
| Molecular formula | C10H17F2NO4 |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | tert-butyl 3,3-difluoro-4-oxopiperidine-1-carboxylate;hydrate |
| InChIKey | IEESRSKOIOREKD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(C1)(F)F.O |
Computed by PubChem (NCBI)