CAS 2931890-04-7 appears in our catalog under these names: (S)-4-((tert-Butoxycarbonyl)amino)-5,5-difluoropentanoic acid, 98%, (4S)-4-{[(tert-butoxy)carbonyl]amino}-5,5-difluoropentanoic acid, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 1g, 250mg, 500mg.
(4S)-5,5-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 2931890-04-7) is a chemical compound with the molecular formula C10H17F2NO4 and a molecular weight of 253.24 g/mol. IUPAC name: (4S)-5,5-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: QQMVIXDQPWLOKT-LURJTMIESA-N.
| Molecular formula | C10H17F2NO4 |
|---|---|
| Molecular weight | 253.24 g/mol |
| IUPAC name | (4S)-5,5-difluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | QQMVIXDQPWLOKT-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)O)C(F)F |
Computed by PubChem (NCBI)