2-AMINO-4-BROMO-3-FLUOROBENZOIC ACID, 95%
cas: 1416013-62-1 — see every product listed under this CAS number, including other names
2-AMINO-4-BROMO-3-FLUOROBENZOIC ACID, 95% (CAS 1416013-62-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F499769-1G |
| cas | 1416013-62-1 |
| size | 1g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 299.91 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 50g | 1086.09 Pln | |
| Fluorochem | 100g | 2028.47 Pln | |
| Fluorochem | 250g | 4944.11 Pln | |
| Fluorochem | 500g | 9291.54 Pln | |
| Fluorochem | 1kg | 15383.14 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-amino-4-bromo-3-fluorobenzoic acid (CAS 1416013-62-1) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-amino-4-bromo-3-fluorobenzoic acid. InChIKey: SFRJQFICUQFDFU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-amino-4-bromo-3-fluorobenzoic acid |
| InChIKey | SFRJQFICUQFDFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)N)F)Br |
Computed by PubChem (NCBI)