CAS 1416013-62-1 appears in our catalog under these names: 2–Amino–4–bromo–3–fluorobenzoic acid, 2-Amino-4-bromo-3-fluorobenzoic acid 97%, 2-Amino-4-Bromo-3-Fluorobenzoic Acid, 97%, 97%, 2-AMINO-4-BROMO-3-FLUOROBENZOIC ACID, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1000g, 100mg, 250mg, 1g, 10g, 25g, 100g.
2-amino-4-bromo-3-fluorobenzoic acid (CAS 1416013-62-1) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 2-amino-4-bromo-3-fluorobenzoic acid. InChIKey: SFRJQFICUQFDFU-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 2-amino-4-bromo-3-fluorobenzoic acid |
| InChIKey | SFRJQFICUQFDFU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)N)F)Br |
Computed by PubChem (NCBI)