2-Allylisoindoline-1,3-dione, 95%
cas: 5428-09-1 — see every product listed under this CAS number, including other names
2-Allylisoindoline-1,3-dione, 95% (CAS 5428-09-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A162523-100mg |
| cas | 5428-09-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 309.19 Pln | |
| Ambeed | 10g | 492.75 Pln | |
| Ambeed | 25g | 915.50 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 169.96 Pln | |
| BLDpharm | 5g | 325.47 Pln | |
| BLDpharm | 10g | 525.40 Pln | |
| BLDpharm | 25g | 980.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-prop-2-enylisoindole-1,3-dione (CAS 5428-09-1) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-prop-2-enylisoindole-1,3-dione. InChIKey: MHHGQWMCVNQHLG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-prop-2-enylisoindole-1,3-dione |
| InChIKey | MHHGQWMCVNQHLG-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)
Synonyms:
N-Allylphthalimide, 2-Allylisoindoline-1,3-dione, N-(2-Propenyl)phthalimide, 2-prop-2-enylisoindole-1,3-dione, 2-Allyl-1H-isoindole-1,3(2H)-dione, 2-(prop-2-en-1-yl)-1H-isoindole-1,3(2H)-dione, 1H-Isoindole-1,3(2H)-dione, 2-(2-propen-1-yl)-, 2-(prop-2-en-1-yl)-2,3-dihydro-1H-isoindole-1,3-dione, 2-(2-propenyl)-1H-Isoindole-1,3(2H)-dione, N-Allylphthalimid