cas: 79979-69-4 — see every product listed under this CAS number, including other names
2-Amino-1-naphthoic acid 97% (CAS 79979-69-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A679974-100mg |
| cas | 79979-69-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 620.69 Pln | |
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2584.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A679974 |
2-aminonaphthalene-1-carboxylic acid (CAS 79979-69-4) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 2-aminonaphthalene-1-carboxylic acid. InChIKey: CXOWHCCVISNMIX-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 2-aminonaphthalene-1-carboxylic acid |
| InChIKey | CXOWHCCVISNMIX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(=O)O)N |
Computed by PubChem (NCBI)