2-Amino-2-(3,4,5-trifluorophenyl)ethanol 97%
cas: 870852-79-2 — see every product listed under this CAS number, including other names
2-Amino-2-(3,4,5-trifluorophenyl)ethanol 97% (CAS 870852-79-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A626591-5g |
| cas | 870852-79-2 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 8280.25 Pln | |
| Ambeed | 100mg | 520.56 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 2122.56 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A626591 |
2-amino-2-(3,4,5-trifluorophenyl)ethanol (CAS 870852-79-2) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 2-amino-2-(3,4,5-trifluorophenyl)ethanol. InChIKey: HHEXZBORTSEZEF-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 2-amino-2-(3,4,5-trifluorophenyl)ethanol |
| InChIKey | HHEXZBORTSEZEF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(CO)N |
Computed by PubChem (NCBI)