cas: 870852-79-2 — see every product listed under this CAS number, including other names
2-Amino-2-(3,4,5-trifluorophenyl)ethanol, 97%, 97% (CAS 870852-79-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AEBP-100mg |
| cas | 870852-79-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 2186.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(3,4,5-trifluorophenyl)ethanol (CAS 870852-79-2) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: 2-amino-2-(3,4,5-trifluorophenyl)ethanol. InChIKey: HHEXZBORTSEZEF-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | 2-amino-2-(3,4,5-trifluorophenyl)ethanol |
| InChIKey | HHEXZBORTSEZEF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)C(CO)N |
Computed by PubChem (NCBI)