CAS 1213556-08-1 appears in our catalog under these names: (S)-2-amino-2-(3,4,5-trifluorophenyl)ethan-1-ol, 98%, (S)-2-Amino-2-(3,4,5-trifluorophenyl)ethan-1-ol, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol (CAS 1213556-08-1) is a chemical compound with the molecular formula C8H8F3NO and a molecular weight of 191.15 g/mol. IUPAC name: (2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol. InChIKey: HHEXZBORTSEZEF-SSDOTTSWSA-N.
| Molecular formula | C8H8F3NO |
|---|---|
| Molecular weight | 191.15 g/mol |
| IUPAC name | (2S)-2-amino-2-(3,4,5-trifluorophenyl)ethanol |
| InChIKey | HHEXZBORTSEZEF-SSDOTTSWSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)[C@@H](CO)N |
Computed by PubChem (NCBI)