cas: 1137014-87-9 — see every product listed under this CAS number, including other names
2-Amino-2-(3,5-dichlorophenyl)acetic acid hydrochloride, 95%, 95% (CAS 1137014-87-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1110DF-5g |
| cas | 1137014-87-9 |
| size | 5g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 3606.80 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 947.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride (CAS 1137014-87-9) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride. InChIKey: CPQMVIKDRJMUKS-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO2 |
|---|---|
| Molecular weight | 256.5 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)acetic acid;hydrochloride |
| InChIKey | CPQMVIKDRJMUKS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)