CAS 2072084-91-2 is the registry number for 2,4,6-Trichloro-3,5-dimethoxyaniline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trichloro-3,5-dimethoxyaniline (CAS 2072084-91-2) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 2,4,6-trichloro-3,5-dimethoxyaniline. InChIKey: WRSVRWNOPOCUBA-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO2 |
|---|---|
| Molecular weight | 256.5 g/mol |
| IUPAC name | 2,4,6-trichloro-3,5-dimethoxyaniline |
| InChIKey | WRSVRWNOPOCUBA-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1Cl)N)Cl)OC)Cl |
Computed by PubChem (NCBI)