CAS 2378501-46-1 is the registry number for 2-Amino-2-(2,6-dichlorophenyl)acetic acid hydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 5g.
2-amino-2-(2,6-dichlorophenyl)acetic acid;hydrochloride (CAS 2378501-46-1) is a chemical compound with the molecular formula C8H8Cl3NO2 and a molecular weight of 256.5 g/mol. IUPAC name: 2-amino-2-(2,6-dichlorophenyl)acetic acid;hydrochloride. InChIKey: HIAZDGJYMLDCOZ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO2 |
|---|---|
| Molecular weight | 256.5 g/mol |
| IUPAC name | 2-amino-2-(2,6-dichlorophenyl)acetic acid;hydrochloride |
| InChIKey | HIAZDGJYMLDCOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)