cas: 372144-00-8 — see every product listed under this CAS number, including other names
2-Amino-2-(3,5-dichlorophenyl)ethanol, 97% (CAS 372144-00-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A212344-5g |
| cas | 372144-00-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9581.11 Pln | |
| AmBeed | 10g | 15850.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-2-(3,5-dichlorophenyl)ethanol (CAS 372144-00-8) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 2-amino-2-(3,5-dichlorophenyl)ethanol. InChIKey: LRORZXIRKBZZAG-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 2-amino-2-(3,5-dichlorophenyl)ethanol |
| InChIKey | LRORZXIRKBZZAG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(CO)N |
Computed by PubChem (NCBI)