CAS 1213008-01-5 is the registry number for (2R)-2-Amino-2-(3,4-dichlorophenyl)ethan-1-ol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg.
(2R)-2-amino-2-(3,4-dichlorophenyl)ethanol (CAS 1213008-01-5) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: (2R)-2-amino-2-(3,4-dichlorophenyl)ethanol. InChIKey: LXYGOSJYDNZVTO-QMMMGPOBSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | (2R)-2-amino-2-(3,4-dichlorophenyl)ethanol |
| InChIKey | LXYGOSJYDNZVTO-QMMMGPOBSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](CO)N)Cl)Cl |
Computed by PubChem (NCBI)