CAS 2055848-78-5 appears in our catalog under these names: (3S)-7-Chloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, (S)–7–Chloro–2,3–dihydrobenzofuran–3–amine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(3S)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2055848-78-5) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: (3S)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: ZYALWTPSNQGZCN-OGFXRTJISA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | (3S)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | ZYALWTPSNQGZCN-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)