CAS 126674-78-0 appears in our catalog under these names: 2–Amino–3,5–difluorobenzoic acid, 2-Amino-3,5-difluorobenzoic acid, 98%, 98%, 2-Amino-3,5-difluorobenzoic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g, 10g, 100g, 500g.
2-amino-3,5-difluorobenzoic acid (CAS 126674-78-0) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 2-amino-3,5-difluorobenzoic acid. InChIKey: NORJRQVQTYNLAO-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 2-amino-3,5-difluorobenzoic acid |
| InChIKey | NORJRQVQTYNLAO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)N)F)F |
Computed by PubChem (NCBI)