cas: 1356182-56-3 — see every product listed under this CAS number, including other names
2-Amino-3-(2-oxo-1,2-dihydroquinolin-4-yl)propanoic acid hydrochloride hydrate, 97% (CAS 1356182-56-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1359478-5g |
| cas | 1356182-56-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 154.63 Pln | |
| AmBeed | 25g | 239.26 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrate;hydrochloride (CAS 1356182-56-3) is a chemical compound with the molecular formula C12H15ClN2O4 and a molecular weight of 286.71 g/mol. IUPAC name: 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrate;hydrochloride. InChIKey: ZSQZQONBUIXIAB-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O4 |
|---|---|
| Molecular weight | 286.71 g/mol |
| IUPAC name | 2-amino-3-(2-oxo-1H-quinolin-4-yl)propanoic acid;hydrate;hydrochloride |
| InChIKey | ZSQZQONBUIXIAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)N2)CC(C(=O)O)N.O.Cl |
Computed by PubChem (NCBI)