cas: 825-22-9 — see every product listed under this CAS number, including other names
2-Amino-3-fluorobenzoic Acid, >98.0%(HPLC)(T) (CAS 825-22-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0570-1G |
| cas | 825-22-9 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 167.52 Pln | |
| TCI | 5g | 477.30 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2-amino-3-fluorobenzoic acid (CAS 825-22-9) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 2-amino-3-fluorobenzoic acid. InChIKey: KUHAYJJXXGBYBW-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2 |
|---|---|
| Molecular weight | 155.13 g/mol |
| IUPAC name | 2-amino-3-fluorobenzoic acid |
| InChIKey | KUHAYJJXXGBYBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)C(=O)O |
Computed by PubChem (NCBI)