Products 825-22-9
CAS 825-22-9 appears in our catalog under these names: 2-Amino-3-fluorobenzoic acid, 98%, 3–Fluoroanthranilic Acid, 2-Amino-3-fluorobenzoic acid, 2-Amino-3-fluorobenzoic Acid, >98.0%(HPLC)(T), 2-Amino-3-fluorobenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 50g, 1000g, 10g, 500g.
2-amino-3-fluorobenzoic acid (CAS 825-22-9) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 2-amino-3-fluorobenzoic acid. InChIKey: KUHAYJJXXGBYBW-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2 |
|---|---|
| Molecular weight | 155.13 g/mol |
| IUPAC name | 2-amino-3-fluorobenzoic acid |
| InChIKey | KUHAYJJXXGBYBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)N)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-3-fluorobenzoic acid, 3-Fluoroanthranilic Acid, 2-amino-3-fluoro-benzoic acid, Benzoic acid, 2-amino-3-fluoro-, 2-amino-3-fluorobenzenecarboxylic acid, 4owm, 3-fluoroanthranilate, 2-Azanyl-3-Fluoranyl-Benzoic Acid, 2-Amino-3-fluorobenzoic acid #, 2-Amino-3-fluorobenzoic acid, AldrichCPR