CAS 446-11-7 appears in our catalog under these names: 4-Fluoro-3-nitrotoluene, 98%, 4–Fluoro–3–nitrotoluene, 4-Fluoro-3-nitrotoluene, 98% , 4-Fluoro-3-nitrotoluene, >98.0%(GC), 4-Fluoro-3-nitrotoluene 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 500g, 1kg, 100g, 25g, 5g, 10g, 1000g, 1g.
1-fluoro-4-methyl-2-nitrobenzene (CAS 446-11-7) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 1-fluoro-4-methyl-2-nitrobenzene. InChIKey: OORBDHOQLZRIQR-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO2 |
|---|---|
| Molecular weight | 155.13 g/mol |
| IUPAC name | 1-fluoro-4-methyl-2-nitrobenzene |
| InChIKey | OORBDHOQLZRIQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)