Products 1094345-91-1

CAS 1094345-91-1 appears in our catalog under these names: 2-Fluoro-5-methylisonicotinic acid, 95%, 2-Fluoro-5-methylpyridine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-fluoro-5-methylpyridine-4-carboxylic acid (CAS 1094345-91-1) is a chemical compound with the molecular formula C7H6FNO2 and a molecular weight of 155.13 g/mol. IUPAC name: 2-fluoro-5-methylpyridine-4-carboxylic acid. InChIKey: DSDTZXBKLGFIEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6FNO2
Molecular weight155.13 g/mol
IUPAC name2-fluoro-5-methylpyridine-4-carboxylic acid
InChIKeyDSDTZXBKLGFIEZ-UHFFFAOYSA-N
SMILESCC1=CN=C(C=C1C(=O)O)F

Computed by PubChem (NCBI)