cas: 134136-03-1 — see every product listed under this CAS number, including other names
2-Amino-4,5,6,7-tetrahydrobenzo(d)thiazole-6-carboxylic acid, 95+% (CAS 134136-03-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A400605-5g |
| cas | 134136-03-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6163.36 Pln | |
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 25g | 18350.08 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid (CAS 134136-03-1) is a chemical compound with the molecular formula C8H10N2O2S and a molecular weight of 198.24 g/mol. IUPAC name: 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid. InChIKey: PABNPIILXVLZMR-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2S |
|---|---|
| Molecular weight | 198.24 g/mol |
| IUPAC name | 2-amino-4,5,6,7-tetrahydro-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | PABNPIILXVLZMR-UHFFFAOYSA-N |
| SMILES | C1CC2=C(CC1C(=O)O)SC(=N2)N |
Computed by PubChem (NCBI)