cas: 211374-80-0 — see every product listed under this CAS number, including other names
2-Amino-4,5-difluorobenzamide, 95% (CAS 211374-80-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 50mg, 100mg, 250mg, 500mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | HA-7177-1g |
| cas | 211374-80-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Fluorochem | 50mg | 706.02 Pln | |
| Fluorochem | 100mg | 1028.82 Pln | |
| Fluorochem | 250mg | 1481.79 Pln | |
| Fluorochem | 500mg | 2314.83 Pln | |
| Fluorochem | 1g | 2861.51 Pln | |
| Fluorochem | 2.5g | 5850.04 Pln | |
| Fluorochem | 5g | 11639.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-amino-4,5-difluorobenzamide (CAS 211374-80-0) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2-amino-4,5-difluorobenzamide. InChIKey: JFMDZCSBKULXCB-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-amino-4,5-difluorobenzamide |
| InChIKey | JFMDZCSBKULXCB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)N)C(=O)N |
Computed by PubChem (NCBI)