cas: 211374-80-0 — see every product listed under this CAS number, including other names
2-Amino-4,5-difluorobenzamide, 98%, 98% (CAS 211374-80-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12AUCW-50mg |
| cas | 211374-80-0 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 534.80 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1058.00 Pln | |
| Chemat | 500mg | 1806.80 Pln | |
| Chemat | 1g | 2075.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-amino-4,5-difluorobenzamide (CAS 211374-80-0) is a chemical compound with the molecular formula C7H6F2N2O and a molecular weight of 172.13 g/mol. IUPAC name: 2-amino-4,5-difluorobenzamide. InChIKey: JFMDZCSBKULXCB-UHFFFAOYSA-N.
| Molecular formula | C7H6F2N2O |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-amino-4,5-difluorobenzamide |
| InChIKey | JFMDZCSBKULXCB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)N)C(=O)N |
Computed by PubChem (NCBI)