CAS 226711-13-3 is the registry number for 2-Amino-4,6-dinitrobenzenemethanol, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: HPC Standards. Available pack sizes: 1x1ml.
(2-amino-4,6-dinitrophenyl)methanol (CAS 226711-13-3) is a chemical compound with the molecular formula C7H7N3O5 and a molecular weight of 213.15 g/mol. IUPAC name: (2-amino-4,6-dinitrophenyl)methanol. InChIKey: LGSMQOJOUHHVIW-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O5 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (2-amino-4,6-dinitrophenyl)methanol |
| InChIKey | LGSMQOJOUHHVIW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)CO)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)