cas: 108481-92-1 — see every product listed under this CAS number, including other names
2-Amino-4-(4-isopropylphenyl)thiazole 98% (CAS 108481-92-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124381-250mg |
| cas | 108481-92-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 893.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A124381 |
4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine (CAS 108481-92-1) is a chemical compound with the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. IUPAC name: 4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine. InChIKey: UFBAQAAATDLTAZ-UHFFFAOYSA-N.
| Molecular formula | C12H14N2S |
|---|---|
| Molecular weight | 218.32 g/mol |
| IUPAC name | 4-(4-propan-2-ylphenyl)-1,3-thiazol-2-amine |
| InChIKey | UFBAQAAATDLTAZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CSC(=N2)N |
Computed by PubChem (NCBI)